C27H39NO3 — CID 67815162
11-[(2-hydroxy-2-phenylethyl)amino]-2-(2-phenylethyl)undecanoic acid (PubChem CID 67815162) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is 11-[(2-hydroxy-2-phenylethyl)amino]-2-(2-phenylethyl)undecanoic acid.
| Compound Name | 11-[(2-hydroxy-2-phenylethyl)amino]-2-(2-phenylethyl)undecanoic acid |
|---|---|
| PubChem CID | 67815162 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 11-[(2-hydroxy-2-phenylethyl)amino]-2-(2-phenylethyl)undecanoic acid |
| SMILES | O=C(O)C(CCCCCCCCCNCC(O)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C27H39NO3/c29-26(24-16-11-7-12-17-24)22-28-21-13-5-3-1-2-4-10-18-25(27(30)31)20-19-23-14-8-6-9-15-23/h6-9,11-12,14-17,25-26,28-29H,1-5,10,13,18-22H2,(H,30,31) |
| InChIKey | MDFZIIWUUHJYCE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|