C22H26Cl2N2O7 — CID 67712743
5-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzylpentanoic acid;oxalic acid (PubChem CID 67712743) has the molecular formula C22H26Cl2N2O7 and a molecular weight of 501.36 g/mol. Its IUPAC name is 5-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzylpentanoic acid;oxalic acid.
| Compound Name | 5-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzylpentanoic acid;oxalic acid |
|---|---|
| PubChem CID | 67712743 |
| Molecular Formula | C22H26Cl2N2O7 |
| Molecular Weight | 501.36 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 5-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-benzylpentanoic acid;oxalic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCC(Cc2ccccc2)C(=O)O)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H24Cl2N2O3.C2H2O4/c21-16-10-15(11-17(22)19(16)23)18(25)12-24-8-4-7-14(20(26)27)9-13-5-2-1-3-6-13;3-1(4)2(5)6/h1-3,5-6,10-11,14,18,24-25H,4,7-9,12,23H2,(H,26,27);(H,3,4)(H,5,6) |
| InChIKey | CRUGPOQDUHNKPO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|