C28H32Cl2N2O4 — CID 158221563
6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexyl 2-(2-phenylphenoxy)acetate (PubChem CID 158221563) has the molecular formula C28H32Cl2N2O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexyl 2-(2-phenylphenoxy)acetate.
| Compound Name | 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexyl 2-(2-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 158221563 |
| Molecular Formula | C28H32Cl2N2O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexyl 2-(2-phenylphenoxy)acetate |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCOC(=O)COc2ccccc2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C28H32Cl2N2O4/c29-23-16-21(17-24(30)28(23)31)25(33)18-32-14-8-1-2-9-15-35-27(34)19-36-26-13-7-6-12-22(26)20-10-4-3-5-11-20/h3-7,10-13,16-17,25,32-33H,1-2,8-9,14-15,18-19,31H2 |
| InChIKey | GDHOHYRUMQFHQU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|