C46H62Cl4N6O8 — CID 6446658
bis((1S)-1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-2-ylethoxy)hexylamino]ethanol);(E)-but-2-enedioic acid (PubChem CID 6446658) has the molecular formula C46H62Cl4N6O8 and a molecular weight of 968.85 g/mol. Its IUPAC name is bis((1S)-1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-2-ylethoxy)hexylamino]ethanol);(E)-but-2-enedioic acid.
| Compound Name | bis((1S)-1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-2-ylethoxy)hexylamino]ethanol);(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 6446658 |
| Molecular Formula | C46H62Cl4N6O8 |
| Molecular Weight | 968.85 g/mol |
| Exact Mass | 966.34 |
| IUPAC Name | bis((1S)-1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-2-ylethoxy)hexylamino]ethanol);(E)-but-2-enedioic acid |
| SMILES | Nc1c(Cl)cc([C@H](O)CNCCCCCCOCCc2ccccn2)cc1Cl.Nc1c(Cl)cc([C@H](O)CNCCCCCCOCCc2ccccn2)cc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C21H29Cl2N3O2.C4H4O4/c2*22-18-13-16(14-19(23)21(18)24)20(27)15-25-9-4-1-2-6-11-28-12-8-17-7-3-5-10-26-17;5-3(6)1-2-4(7)8/h2*3,5,7,10,13-14,20,25,27H,1-2,4,6,8-9,11-12,15,24H2;1-2H,(H,5,6)(H,7,8)/b;;2-1+/t2*20-;/m11./s1 |
| InChIKey | MZHXOYZUNRCUCP-OIXNQWMBSA-N |
| XLogP | 8.54 |
| TPSA | 235.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.85 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|