C25H35Cl2N3O5 — CID 23045056
acetic acid;N-[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-N-[6-(2-pyridin-2-ylethoxy)hexyl]acetamide (PubChem CID 23045056) has the molecular formula C25H35Cl2N3O5 and a molecular weight of 528.48 g/mol. Its IUPAC name is acetic acid;N-[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-N-[6-(2-pyridin-2-ylethoxy)hexyl]acetamide.
| Compound Name | acetic acid;N-[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-N-[6-(2-pyridin-2-ylethoxy)hexyl]acetamide |
|---|---|
| PubChem CID | 23045056 |
| Molecular Formula | C25H35Cl2N3O5 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | acetic acid;N-[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-N-[6-(2-pyridin-2-ylethoxy)hexyl]acetamide |
| SMILES | CC(=O)N(CCCCCCOCCc1ccccn1)CC(O)c1cc(Cl)c(N)c(Cl)c1.CC(=O)O |
| InChI | InChI=1S/C23H31Cl2N3O3.C2H4O2/c1-17(29)28(16-22(30)18-14-20(24)23(26)21(25)15-18)11-6-2-3-7-12-31-13-9-19-8-4-5-10-27-19;1-2(3)4/h4-5,8,10,14-15,22,30H,2-3,6-7,9,11-13,16,26H2,1H3;1H3,(H,3,4) |
| InChIKey | OEWUPOCWMWMJOQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|