C29H37Cl2N3O2 — CID 19876760
1-(4-amino-3,5-dichlorophenyl)-2-[benzyl-[6-(2-pyridin-2-ylethoxy)hexyl]amino]propan-1-ol (PubChem CID 19876760) has the molecular formula C29H37Cl2N3O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[benzyl-[6-(2-pyridin-2-ylethoxy)hexyl]amino]propan-1-ol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[benzyl-[6-(2-pyridin-2-ylethoxy)hexyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 19876760 |
| Molecular Formula | C29H37Cl2N3O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[benzyl-[6-(2-pyridin-2-ylethoxy)hexyl]amino]propan-1-ol |
| SMILES | CC(C(O)c1cc(Cl)c(N)c(Cl)c1)N(CCCCCCOCCc1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C29H37Cl2N3O2/c1-22(29(35)24-19-26(30)28(32)27(31)20-24)34(21-23-11-5-4-6-12-23)16-9-2-3-10-17-36-18-14-25-13-7-8-15-33-25/h4-8,11-13,15,19-20,22,29,35H,2-3,9-10,14,16-18,21,32H2,1H3 |
| InChIKey | NVUOFYMKRZDWSL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|