C25H33Cl2N3O6 — CID 158752133
1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-3-ylethoxy)hexylamino]ethanol;(E)-but-2-enedioic acid (PubChem CID 158752133) has the molecular formula C25H33Cl2N3O6 and a molecular weight of 542.46 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-3-ylethoxy)hexylamino]ethanol;(E)-but-2-enedioic acid.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-3-ylethoxy)hexylamino]ethanol;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 158752133 |
| Molecular Formula | C25H33Cl2N3O6 |
| Molecular Weight | 542.46 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-(2-pyridin-3-ylethoxy)hexylamino]ethanol;(E)-but-2-enedioic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCOCCc2cccnc2)cc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H29Cl2N3O2.C4H4O4/c22-18-12-17(13-19(23)21(18)24)20(27)15-26-8-3-1-2-4-10-28-11-7-16-6-5-9-25-14-16;5-3(6)1-2-4(7)8/h5-6,9,12-14,20,26-27H,1-4,7-8,10-11,15,24H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | INPPCHIFKLPWIX-WLHGVMLRSA-N |
| XLogP | 4.13 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|