C25H35Cl2N3O4 — CID 19854796
ethyl 4-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]propyl]pyridine-2-carboxylate (PubChem CID 19854796) has the molecular formula C25H35Cl2N3O4 and a molecular weight of 512.48 g/mol. Its IUPAC name is ethyl 4-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]propyl]pyridine-2-carboxylate.
| Compound Name | ethyl 4-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]propyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19854796 |
| Molecular Formula | C25H35Cl2N3O4 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | ethyl 4-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]propyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(CCCOCCCCCCNCC(O)c2cc(Cl)c(N)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C25H35Cl2N3O4/c1-2-34-25(32)22-14-18(9-11-30-22)8-7-13-33-12-6-4-3-5-10-29-17-23(31)19-15-20(26)24(28)21(27)16-19/h9,11,14-16,23,29,31H,2-8,10,12-13,17,28H2,1H3 |
| InChIKey | QZFZUXKMKWAAAB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|