About 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol
1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol (PubChem CID 19996127) has the molecular formula C21H30Cl2N2O3
and a molecular weight of 429.39 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol.
Molecular Properties
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol |
| PubChem CID | 19996127 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCOCCCc2ccco2)cc1Cl |
| InChI | InChI=1S/C21H30Cl2N2O3/c22-18-13-16(14-19(23)21(18)24)20(26)15-25-9-3-1-2-4-10-27-11-5-7-17-8-6-12-28-17/h6,8,12-14,20,25-26H,1-5,7,9-11,15,24H2 |
| InChIKey | WZYGXOMTDOFMGC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol?
The IUPAC name of 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol (CID 19996127) is 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol.
What is the SMILES notation for 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol?
The canonical SMILES for 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol is Nc1c(Cl)cc(C(O)CNCCCCCCOCCCc2ccco2)cc1Cl.
What is the InChIKey of 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol?
The InChIKey is WZYGXOMTDOFMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30Cl2N2O3/c22-18-13-16(14-19(23)21(18)24)20(26)15-25-9-3-1-2-4-10-27-11-5-7-17-8-6-12-28-17/h6,8,12-14,20,25-26H,1-5,7,9-11,15,24H2.
What are the key properties of 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol?
1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol has a molecular weight of 429.39 g/mol, XLogP of 5.00, 14 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol is sourced from PubChem (CID 19996127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).