C21H30Cl2N2O3 — CID 19996127
1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol (PubChem CID 19996127) has the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.39 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol |
|---|---|
| PubChem CID | 19996127 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(furan-2-yl)propoxy]hexylamino]ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCOCCCc2ccco2)cc1Cl |
| InChI | InChI=1S/C21H30Cl2N2O3/c22-18-13-16(14-19(23)21(18)24)20(26)15-25-9-3-1-2-4-10-27-11-5-7-17-8-6-12-28-17/h6,8,12-14,20,25-26H,1-5,7,9-11,15,24H2 |
| InChIKey | WZYGXOMTDOFMGC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|