C23H30Cl2N2O3 — CID 23352639
2-[2-[7-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]heptyl]phenyl]acetic acid (PubChem CID 23352639) has the molecular formula C23H30Cl2N2O3 and a molecular weight of 453.41 g/mol. Its IUPAC name is 2-[2-[7-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]heptyl]phenyl]acetic acid.
| Compound Name | 2-[2-[7-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]heptyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 23352639 |
| Molecular Formula | C23H30Cl2N2O3 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-[2-[7-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]heptyl]phenyl]acetic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCCc2ccccc2CC(=O)O)cc1Cl |
| InChI | InChI=1S/C23H30Cl2N2O3/c24-19-12-18(13-20(25)23(19)26)21(28)15-27-11-7-3-1-2-4-8-16-9-5-6-10-17(16)14-22(29)30/h5-6,9-10,12-13,21,27-28H,1-4,7-8,11,14-15,26H2,(H,29,30) |
| InChIKey | NBAACJIUYAYJQH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|