About 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol
2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol (PubChem CID 14210576) has the molecular formula C23H33Cl2N3O3
and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol |
| PubChem CID | 14210576 |
| Molecular Formula | C23H33Cl2N3O3 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCCOCCCCc2ncccc2O)cc1Cl |
| InChI | InChI=1S/C23H33Cl2N3O3/c24-18-14-17(15-19(25)23(18)26)22(30)16-27-10-4-1-2-5-12-31-13-6-3-8-20-21(29)9-7-11-28-20/h7,9,11,14-15,22,27,29-30H,1-6,8,10,12-13,16,26H2 |
| InChIKey | JZBSZFICEZGOHP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol?
The IUPAC name of 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol (CID 14210576) is 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol.
What is the SMILES notation for 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol?
The canonical SMILES for 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol is Nc1c(Cl)cc(C(O)CNCCCCCCOCCCCc2ncccc2O)cc1Cl.
What is the InChIKey of 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol?
The InChIKey is JZBSZFICEZGOHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33Cl2N3O3/c24-18-14-17(15-19(25)23(18)26)22(30)16-27-10-4-1-2-5-12-31-13-6-3-8-20-21(29)9-7-11-28-20/h7,9,11,14-15,22,27,29-30H,1-6,8,10,12-13,16,26H2.
What are the key properties of 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol?
2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol has a molecular weight of 470.44 g/mol, XLogP of 4.90, 15 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]hexoxy]butyl]pyridin-3-ol is sourced from PubChem (CID 14210576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).