C22H32Cl2N4O2 — CID 19854817
1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(6-amino-2-pyridinyl)propoxy]hexylamino]ethanol (PubChem CID 19854817) has the molecular formula C22H32Cl2N4O2 and a molecular weight of 455.43 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(6-amino-2-pyridinyl)propoxy]hexylamino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(6-amino-2-pyridinyl)propoxy]hexylamino]ethanol |
|---|---|
| PubChem CID | 19854817 |
| Molecular Formula | C22H32Cl2N4O2 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[6-[3-(6-amino-2-pyridinyl)propoxy]hexylamino]ethanol |
| SMILES | Nc1cccc(CCCOCCCCCCNCC(O)c2cc(Cl)c(N)c(Cl)c2)n1 |
| InChI | InChI=1S/C22H32Cl2N4O2/c23-18-13-16(14-19(24)22(18)26)20(29)15-27-10-3-1-2-4-11-30-12-6-8-17-7-5-9-21(25)28-17/h5,7,9,13-14,20,27,29H,1-4,6,8,10-12,15,26H2,(H2,25,28) |
| InChIKey | WIPKDMXEDFDPRD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|