C24H32Cl2N2O3 — CID 23352580
8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(1-phenylethyl)octanoic acid (PubChem CID 23352580) has the molecular formula C24H32Cl2N2O3 and a molecular weight of 467.44 g/mol. Its IUPAC name is 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(1-phenylethyl)octanoic acid.
| Compound Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(1-phenylethyl)octanoic acid |
|---|---|
| PubChem CID | 23352580 |
| Molecular Formula | C24H32Cl2N2O3 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-(1-phenylethyl)octanoic acid |
| SMILES | CC(c1ccccc1)C(CCCCCCNCC(O)c1cc(Cl)c(N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C24H32Cl2N2O3/c1-16(17-9-5-4-6-10-17)19(24(30)31)11-7-2-3-8-12-28-15-22(29)18-13-20(25)23(27)21(26)14-18/h4-6,9-10,13-14,16,19,22,28-29H,2-3,7-8,11-12,15,27H2,1H3,(H,30,31) |
| InChIKey | NUOVKXCIIUAJRR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|