C26H30Cl2N2O3 — CID 57266153
8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3-naphthalen-1-yloctanoic acid (PubChem CID 57266153) has the molecular formula C26H30Cl2N2O3 and a molecular weight of 489.44 g/mol. Its IUPAC name is 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3-naphthalen-1-yloctanoic acid.
| Compound Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3-naphthalen-1-yloctanoic acid |
|---|---|
| PubChem CID | 57266153 |
| Molecular Formula | C26H30Cl2N2O3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 8-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3-naphthalen-1-yloctanoic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCCCCC(CC(=O)O)c2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C26H30Cl2N2O3/c27-22-13-19(14-23(28)26(22)29)24(31)16-30-12-5-1-2-8-18(15-25(32)33)21-11-6-9-17-7-3-4-10-20(17)21/h3-4,6-7,9-11,13-14,18,24,30-31H,1-2,5,8,12,15-16,29H2,(H,32,33) |
| InChIKey | WSFVANFALJVUJX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|