C24H28Cl2N2O8 — CID 23352581
2-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethoxy]ethyl 2-phenylacetate;(E)-but-2-enedioic acid (PubChem CID 23352581) has the molecular formula C24H28Cl2N2O8 and a molecular weight of 543.40 g/mol. Its IUPAC name is 2-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethoxy]ethyl 2-phenylacetate;(E)-but-2-enedioic acid.
| Compound Name | 2-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethoxy]ethyl 2-phenylacetate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 23352581 |
| Molecular Formula | C24H28Cl2N2O8 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-[2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]ethoxy]ethyl 2-phenylacetate;(E)-but-2-enedioic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNCCOCCOC(=O)Cc2ccccc2)cc1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C20H24Cl2N2O4.C4H4O4/c21-16-11-15(12-17(22)20(16)23)18(25)13-24-6-7-27-8-9-28-19(26)10-14-4-2-1-3-5-14;5-3(6)1-2-4(7)8/h1-5,11-12,18,24-25H,6-10,13,23H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KCTOOOCZCUMNJM-WLHGVMLRSA-N |
| XLogP | 2.71 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|