C27H26Cl2N2O5 — CID 171150770
1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol;but-2-enedioic acid (PubChem CID 171150770) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol;but-2-enedioic acid.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol;but-2-enedioic acid |
|---|---|
| PubChem CID | 171150770 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol;but-2-enedioic acid |
| SMILES | Nc1c(Cl)cc(C(O)CNC2c3ccccc3CCc3ccccc32)cc1Cl.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H22Cl2N2O.C4H4O4/c24-19-11-16(12-20(25)22(19)26)21(28)13-27-23-17-7-3-1-5-14(17)9-10-15-6-2-4-8-18(15)23;5-3(6)1-2-4(7)8/h1-8,11-12,21,23,27-28H,9-10,13,26H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BGYSPUMOSIOUNO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|