C18H19ClN2O2 — CID 110887524
1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 110887524) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 110887524 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-hydroxyethyl]-3-(2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | O=C(NCC(O)c1ccc(Cl)cc1)NC1CCc2ccccc21 |
| InChI | InChI=1S/C18H19ClN2O2/c19-14-8-5-13(6-9-14)17(22)11-20-18(23)21-16-10-7-12-3-1-2-4-15(12)16/h1-6,8-9,16-17,22H,7,10-11H2,(H2,20,21,23) |
| InChIKey | WSWCOSFOTDLNTG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |