C16H24N2O2 — CID 111337898
1-(2,3-dihydro-1H-inden-1-yl)-3-(2-hydroxy-3,3-dimethylbutyl)urea (PubChem CID 111337898) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-hydroxy-3,3-dimethylbutyl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-hydroxy-3,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111337898 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(2-hydroxy-3,3-dimethylbutyl)urea |
| SMILES | CC(C)(C)C(O)CNC(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,3)14(19)10-17-15(20)18-13-9-8-11-6-4-5-7-12(11)13/h4-7,13-14,19H,8-10H2,1-3H3,(H2,17,18,20) |
| InChIKey | BYPWFVZQUUXTFR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |