C15H21N3O2 — CID 42928312
2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-N-ethylpropanamide (PubChem CID 42928312) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-N-ethylpropanamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 42928312 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)NC(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C15H21N3O2/c1-3-16-14(19)10(2)17-15(20)18-13-9-8-11-6-4-5-7-12(11)13/h4-7,10,13H,3,8-9H2,1-2H3,(H,16,19)(H2,17,18,20) |
| InChIKey | HAPNEMRIXWICKD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |