C12H15BrN2O — CID 59355774
1-(2-bromoethyl)-3-(2,3-dihydro-1H-inden-1-yl)urea (PubChem CID 59355774) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3-(2,3-dihydro-1H-inden-1-yl)urea.
| Compound Name | 1-(2-bromoethyl)-3-(2,3-dihydro-1H-inden-1-yl)urea |
|---|---|
| PubChem CID | 59355774 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-(2-bromoethyl)-3-(2,3-dihydro-1H-inden-1-yl)urea |
| SMILES | O=C(NCCBr)NC1CCc2ccccc21 |
| InChI | InChI=1S/C12H15BrN2O/c13-7-8-14-12(16)15-11-6-5-9-3-1-2-4-10(9)11/h1-4,11H,5-8H2,(H2,14,15,16) |
| InChIKey | ZIQFCLUKVYTFNH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|