C15H16N2O2 — CID 47127905
1-(2,3-dihydro-1H-inden-1-yl)-3-(furan-2-ylmethyl)urea (PubChem CID 47127905) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 47127905 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccco1)NC1CCc2ccccc21 |
| InChI | InChI=1S/C15H16N2O2/c18-15(16-10-12-5-3-9-19-12)17-14-8-7-11-4-1-2-6-13(11)14/h1-6,9,14H,7-8,10H2,(H2,16,17,18) |
| InChIKey | BYZBOIOSONIAAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |