C19H20Cl2N4O2 — CID 167266234
3-amino-2,6-dichloro-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]carbamoylamino]ethyl]benzamide (PubChem CID 167266234) has the molecular formula C19H20Cl2N4O2 and a molecular weight of 407.30 g/mol. Its IUPAC name is 3-amino-2,6-dichloro-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]carbamoylamino]ethyl]benzamide.
| Compound Name | 3-amino-2,6-dichloro-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 167266234 |
| Molecular Formula | C19H20Cl2N4O2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-amino-2,6-dichloro-N-[2-[[(1R)-2,3-dihydro-1H-inden-1-yl]carbamoylamino]ethyl]benzamide |
| SMILES | Nc1ccc(Cl)c(C(=O)NCCNC(=O)N[C@@H]2CCc3ccccc32)c1Cl |
| InChI | InChI=1S/C19H20Cl2N4O2/c20-13-6-7-14(22)17(21)16(13)18(26)23-9-10-24-19(27)25-15-8-5-11-3-1-2-4-12(11)15/h1-4,6-7,15H,5,8-10,22H2,(H,23,26)(H2,24,25,27)/t15-/m1/s1 |
| InChIKey | HNTSMIFKUVGVRJ-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|