C23H20F2N2O — CID 97314053
1-[bis(4-fluorophenyl)methyl]-3-[(1S)-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 97314053) has the molecular formula C23H20F2N2O and a molecular weight of 378.42 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methyl]-3-[(1S)-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[bis(4-fluorophenyl)methyl]-3-[(1S)-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 97314053 |
| Molecular Formula | C23H20F2N2O |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methyl]-3-[(1S)-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | O=C(NC(c1ccc(F)cc1)c1ccc(F)cc1)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C23H20F2N2O/c24-18-10-5-16(6-11-18)22(17-7-12-19(25)13-8-17)27-23(28)26-21-14-9-15-3-1-2-4-20(15)21/h1-8,10-13,21-22H,9,14H2,(H2,26,27,28)/t21-/m0/s1 |
| InChIKey | PBCHKYRGOAKRMF-NRFANRHFSA-N |
| XLogP | 5.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |