C20H23FN2O2 — CID 111454816
1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(4-hydroxy-1-phenylbutyl)urea (PubChem CID 111454816) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(4-hydroxy-1-phenylbutyl)urea.
| Compound Name | 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(4-hydroxy-1-phenylbutyl)urea |
|---|---|
| PubChem CID | 111454816 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(5-fluoro-2,3-dihydro-1H-inden-1-yl)-3-(4-hydroxy-1-phenylbutyl)urea |
| SMILES | O=C(NC(CCCO)c1ccccc1)NC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C20H23FN2O2/c21-16-9-10-17-15(13-16)8-11-19(17)23-20(25)22-18(7-4-12-24)14-5-2-1-3-6-14/h1-3,5-6,9-10,13,18-19,24H,4,7-8,11-12H2,(H2,22,23,25) |
| InChIKey | CFHKDGKCMLUSDG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |