C21H24N2O3 — CID 157035661
benzyl (2S)-3-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-2-methylpropanoate (PubChem CID 157035661) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is benzyl (2S)-3-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-2-methylpropanoate.
| Compound Name | benzyl (2S)-3-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-2-methylpropanoate |
|---|---|
| PubChem CID | 157035661 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | benzyl (2S)-3-(2,3-dihydro-1H-inden-1-ylcarbamoylamino)-2-methylpropanoate |
| SMILES | C[C@@H](CNC(=O)NC1CCc2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c1-15(20(24)26-14-16-7-3-2-4-8-16)13-22-21(25)23-19-12-11-17-9-5-6-10-18(17)19/h2-10,15,19H,11-14H2,1H3,(H2,22,23,25)/t15-,19?/m0/s1 |
| InChIKey | PCWFLJQYBJBQEK-FUKCDUGKSA-N |
| XLogP | 3.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |