C23H22Cl2N2O — CID 11834824
1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol (PubChem CID 11834824) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol |
|---|---|
| PubChem CID | 11834824 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CNC2c3ccccc3CCc3ccccc32)cc1Cl |
| InChI | InChI=1S/C23H22Cl2N2O/c24-19-11-16(12-20(25)22(19)26)21(28)13-27-23-17-7-3-1-5-14(17)9-10-15-6-2-4-8-18(15)23/h1-8,11-12,21,23,27-28H,9-10,13,26H2 |
| InChIKey | KNHAYJPWZAIJQG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|