C22H22N4O — CID 168957928
N-(5-amino-3-pyridinyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)acetamide (PubChem CID 168957928) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(5-amino-3-pyridinyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)acetamide.
| Compound Name | N-(5-amino-3-pyridinyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)acetamide |
|---|---|
| PubChem CID | 168957928 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(5-amino-3-pyridinyl)-2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)acetamide |
| SMILES | Nc1cncc(NC(=O)CNC2c3ccccc3CCc3ccccc32)c1 |
| InChI | InChI=1S/C22H22N4O/c23-17-11-18(13-24-12-17)26-21(27)14-25-22-19-7-3-1-5-15(19)9-10-16-6-2-4-8-20(16)22/h1-8,11-13,22,25H,9-10,14,23H2,(H,26,27) |
| InChIKey | CLTAFLZLWXHFMW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |