C16H14Cl2O2 — CID 105133287
(3,4-dichlorophenyl)-(3,4-dihydro-1H-isochromen-1-yl)methanol (PubChem CID 105133287) has the molecular formula C16H14Cl2O2 and a molecular weight of 309.19 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3,4-dihydro-1H-isochromen-1-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(3,4-dihydro-1H-isochromen-1-yl)methanol |
|---|---|
| PubChem CID | 105133287 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (3,4-dichlorophenyl)-(3,4-dihydro-1H-isochromen-1-yl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)C1OCCc2ccccc21 |
| InChI | InChI=1S/C16H14Cl2O2/c17-13-6-5-11(9-14(13)18)15(19)16-12-4-2-1-3-10(12)7-8-20-16/h1-6,9,15-16,19H,7-8H2 |
| InChIKey | RUUAYCHVCOAZBW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |