C16H22O2 — CID 105100583
cyclohexyl(3,4-dihydro-1H-isochromen-1-yl)methanol (PubChem CID 105100583) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is cyclohexyl(3,4-dihydro-1H-isochromen-1-yl)methanol.
| Compound Name | cyclohexyl(3,4-dihydro-1H-isochromen-1-yl)methanol |
|---|---|
| PubChem CID | 105100583 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | cyclohexyl(3,4-dihydro-1H-isochromen-1-yl)methanol |
| SMILES | OC(C1CCCCC1)C1OCCc2ccccc21 |
| InChI | InChI=1S/C16H22O2/c17-15(13-7-2-1-3-8-13)16-14-9-5-4-6-12(14)10-11-18-16/h4-6,9,13,15-17H,1-3,7-8,10-11H2 |
| InChIKey | NTLDOIHVOMDJMZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |