2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid

C17H22O3 — CID 115926238

IUPAC2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid
SMILESO=C(O)C(CC1OCCc2ccccc21)C1CCCC1
InChIInChI=1S/C17H22O3/c18-17(19)15(12-5-1-2-6-12)11-16-14-8-4-3-7-13(14)9-10-20-16/h3-4,7-8,12,15-16H,1-2,5-6,9-11H2,(H,18,19)
InChIKeyVVPWRNWLDBDVFC-UHFFFAOYSA-N
MW274.36 g/mol
LogP3.58
Rot. Bonds4

About 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid

2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid (PubChem CID 115926238) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid.

Molecular Properties

Compound Name2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid
PubChem CID115926238
Molecular FormulaC17H22O3
Molecular Weight274.36 g/mol
Exact Mass274.16
IUPAC Name2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid
SMILESO=C(O)C(CC1OCCc2ccccc21)C1CCCC1
InChIInChI=1S/C17H22O3/c18-17(19)15(12-5-1-2-6-12)11-16-14-8-4-3-7-13(14)9-10-20-16/h3-4,7-8,12,15-16H,1-2,5-6,9-11H2,(H,18,19)
InChIKeyVVPWRNWLDBDVFC-UHFFFAOYSA-N
XLogP3.58
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 53.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid?
The IUPAC name of 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid (CID 115926238) is 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid.
What is the SMILES notation for 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid?
The canonical SMILES for 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid is O=C(O)C(CC1OCCc2ccccc21)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid?
The InChIKey is VVPWRNWLDBDVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O3/c18-17(19)15(12-5-1-2-6-12)11-16-14-8-4-3-7-13(14)9-10-20-16/h3-4,7-8,12,15-16H,1-2,5-6,9-11H2,(H,18,19).
What are the key properties of 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid?
2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid has a molecular weight of 274.36 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-3-(3,4-dihydro-1H-isochromen-1-yl)propanoic acid is sourced from PubChem (CID 115926238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).