C17H16Cl2O2 — CID 115809497
1-(2,5-dichlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanol (PubChem CID 115809497) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanol.
| Compound Name | 1-(2,5-dichlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanol |
|---|---|
| PubChem CID | 115809497 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanol |
| SMILES | OC(CC1OCCc2ccccc21)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl2O2/c18-12-5-6-15(19)14(9-12)16(20)10-17-13-4-2-1-3-11(13)7-8-21-17/h1-6,9,16-17,20H,7-8,10H2 |
| InChIKey | VEARCOVDODVZAM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |