C17H17IO2 — CID 115809682
2-(3,4-dihydro-1H-isochromen-1-yl)-1-(2-iodophenyl)ethanol (PubChem CID 115809682) has the molecular formula C17H17IO2 and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-1-yl)-1-(2-iodophenyl)ethanol.
| Compound Name | 2-(3,4-dihydro-1H-isochromen-1-yl)-1-(2-iodophenyl)ethanol |
|---|---|
| PubChem CID | 115809682 |
| Molecular Formula | C17H17IO2 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-(3,4-dihydro-1H-isochromen-1-yl)-1-(2-iodophenyl)ethanol |
| SMILES | OC(CC1OCCc2ccccc21)c1ccccc1I |
| InChI | InChI=1S/C17H17IO2/c18-15-8-4-3-7-14(15)16(19)11-17-13-6-2-1-5-12(13)9-10-20-17/h1-8,16-17,19H,9-11H2 |
| InChIKey | RZOHHFJKDBYYLK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|