C18H20Cl2N2O — CID 69490564
1-(4-amino-3,5-dichlorophenyl)-2-[[cyclopropyl(phenyl)methyl]amino]ethanol (PubChem CID 69490564) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-2-[[cyclopropyl(phenyl)methyl]amino]ethanol.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[cyclopropyl(phenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 69490564 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-2-[[cyclopropyl(phenyl)methyl]amino]ethanol |
| SMILES | Nc1c(Cl)cc(C(O)CNC(c2ccccc2)C2CC2)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c19-14-8-13(9-15(20)17(14)21)16(23)10-22-18(12-6-7-12)11-4-2-1-3-5-11/h1-5,8-9,12,16,18,22-23H,6-7,10,21H2 |
| InChIKey | UVQOKRDSJIKKBN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|