C20H26N2O — CID 97258708
(1R)-2-[[(S)-cyclohexyl(phenyl)methyl]amino]-1-pyridin-4-ylethanol (PubChem CID 97258708) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (1R)-2-[[(S)-cyclohexyl(phenyl)methyl]amino]-1-pyridin-4-ylethanol.
| Compound Name | (1R)-2-[[(S)-cyclohexyl(phenyl)methyl]amino]-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 97258708 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1R)-2-[[(S)-cyclohexyl(phenyl)methyl]amino]-1-pyridin-4-ylethanol |
| SMILES | O[C@@H](CN[C@H](c1ccccc1)C1CCCCC1)c1ccncc1 |
| InChI | InChI=1S/C20H26N2O/c23-19(16-11-13-21-14-12-16)15-22-20(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18-20,22-23H,2,5-6,9-10,15H2/t19-,20+/m0/s1 |
| InChIKey | IBEIWNMJNNKDNT-VQTJNVASSA-N |
| XLogP | 4.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |