C25H35NO6 — CID 70376298
4-[3-[6-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl]-2-methylbenzoic acid (PubChem CID 70376298) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-[3-[6-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl]-2-methylbenzoic acid.
| Compound Name | 4-[3-[6-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 70376298 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 4-[3-[6-[[2-(3,5-dihydroxyphenyl)-2-hydroxyethyl]amino]hexoxy]propyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(CCCOCCCCCCNCC(O)c2cc(O)cc(O)c2)ccc1C(=O)O |
| InChI | InChI=1S/C25H35NO6/c1-18-13-19(8-9-23(18)25(30)31)7-6-12-32-11-5-3-2-4-10-26-17-24(29)20-14-21(27)16-22(28)15-20/h8-9,13-16,24,26-29H,2-7,10-12,17H2,1H3,(H,30,31) |
| InChIKey | QZMWOKBBKOVLEC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|