C38H46N2O7S — CID 69200606
[2-hydroxy-5-[(1R)-1-hydroxy-2-[7-[3-(3-sulfamoylphenyl)propoxy]heptylamino]ethyl]phenyl]methyl 4-phenylbenzoate (PubChem CID 69200606) has the molecular formula C38H46N2O7S and a molecular weight of 674.86 g/mol. Its IUPAC name is [2-hydroxy-5-[(1R)-1-hydroxy-2-[7-[3-(3-sulfamoylphenyl)propoxy]heptylamino]ethyl]phenyl]methyl 4-phenylbenzoate.
| Compound Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[7-[3-(3-sulfamoylphenyl)propoxy]heptylamino]ethyl]phenyl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 69200606 |
| Molecular Formula | C38H46N2O7S |
| Molecular Weight | 674.86 g/mol |
| Exact Mass | 674.30 |
| IUPAC Name | [2-hydroxy-5-[(1R)-1-hydroxy-2-[7-[3-(3-sulfamoylphenyl)propoxy]heptylamino]ethyl]phenyl]methyl 4-phenylbenzoate |
| SMILES | NS(=O)(=O)c1cccc(CCCOCCCCCCCNC[C@H](O)c2ccc(O)c(COC(=O)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C38H46N2O7S/c39-48(44,45)35-15-9-11-29(25-35)12-10-24-46-23-8-3-1-2-7-22-40-27-37(42)33-20-21-36(41)34(26-33)28-47-38(43)32-18-16-31(17-19-32)30-13-5-4-6-14-30/h4-6,9,11,13-21,25-26,37,40-42H,1-3,7-8,10,12,22-24,27-28H2,(H2,39,44,45)/t37-/m0/s1 |
| InChIKey | YCTVETOPLNVPFV-QNGWXLTQSA-N |
| XLogP | 6.29 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.86 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|