C25H38N2O6S — CID 69199795
3-[6-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butoxy]hexyl]benzenesulfonamide (PubChem CID 69199795) has the molecular formula C25H38N2O6S and a molecular weight of 494.65 g/mol. Its IUPAC name is 3-[6-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butoxy]hexyl]benzenesulfonamide.
| Compound Name | 3-[6-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butoxy]hexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69199795 |
| Molecular Formula | C25H38N2O6S |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 3-[6-[4-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]butoxy]hexyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CCCCCCOCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C25H38N2O6S/c26-34(31,32)23-10-7-9-20(16-23)8-3-1-2-5-14-33-15-6-4-13-27-18-25(30)21-11-12-24(29)22(17-21)19-28/h7,9-12,16-17,25,27-30H,1-6,8,13-15,18-19H2,(H2,26,31,32)/t25-/m1/s1 |
| InChIKey | VLVDEVCGKJEOKJ-RUZDIDTESA-N |
| XLogP | 2.75 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|