C24H36N2O7S — CID 66846313
3-[2-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]benzenesulfonamide (PubChem CID 66846313) has the molecular formula C24H36N2O7S and a molecular weight of 496.63 g/mol. Its IUPAC name is 3-[2-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]benzenesulfonamide.
| Compound Name | 3-[2-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66846313 |
| Molecular Formula | C24H36N2O7S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 3-[2-[6-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(COCCOCCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C24H36N2O7S/c25-34(30,31)22-7-5-6-19(14-22)18-33-13-12-32-11-4-2-1-3-10-26-16-24(29)20-8-9-23(28)21(15-20)17-27/h5-9,14-15,24,26-29H,1-4,10-13,16-18H2,(H2,25,30,31)/t24-/m1/s1 |
| InChIKey | DAXMEJMNFJTTSO-XMMPIXPASA-N |
| XLogP | 1.95 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|