C24H34INO5 — CID 66845001
4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol (PubChem CID 66845001) has the molecular formula C24H34INO5 and a molecular weight of 543.44 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 66845001 |
| Molecular Formula | C24H34INO5 |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 4-[(1R)-1-hydroxy-2-[6-[2-[(3-iodophenyl)methoxy]ethoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc([C@@H](O)CNCCCCCCOCCOCc2cccc(I)c2)ccc1O |
| InChI | InChI=1S/C24H34INO5/c25-22-7-5-6-19(14-22)18-31-13-12-30-11-4-2-1-3-10-26-16-24(29)20-8-9-23(28)21(15-20)17-27/h5-9,14-15,24,26-29H,1-4,10-13,16-18H2/t24-/m0/s1 |
| InChIKey | NKRLXKXTLZHFEW-DEOSSOPVSA-N |
| XLogP | 3.91 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|