C27H42N2O5 — CID 77196027
4-[2-[6-[2-[[3-(dimethylamino)phenyl]methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-(2-hydroxyethyl)phenol (PubChem CID 77196027) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is 4-[2-[6-[2-[[3-(dimethylamino)phenyl]methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-(2-hydroxyethyl)phenol.
| Compound Name | 4-[2-[6-[2-[[3-(dimethylamino)phenyl]methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-(2-hydroxyethyl)phenol |
|---|---|
| PubChem CID | 77196027 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 4-[2-[6-[2-[[3-(dimethylamino)phenyl]methoxy]ethoxy]hexylamino]-1-hydroxyethyl]-2-(2-hydroxyethyl)phenol |
| SMILES | CN(C)c1cccc(COCCOCCCCCCNCC(O)c2ccc(O)c(CCO)c2)c1 |
| InChI | InChI=1S/C27H42N2O5/c1-29(2)25-9-7-8-22(18-25)21-34-17-16-33-15-6-4-3-5-13-28-20-27(32)23-10-11-26(31)24(19-23)12-14-30/h7-11,18-19,27-28,30-32H,3-6,12-17,20-21H2,1-2H3 |
| InChIKey | QZCMQPQBJAUNMV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|