C28H41N3O7 — CID 87837020
[N-carbamoyl-3-[5-[5-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]anilino] acetate (PubChem CID 87837020) has the molecular formula C28H41N3O7 and a molecular weight of 531.65 g/mol. Its IUPAC name is [N-carbamoyl-3-[5-[5-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]anilino] acetate.
| Compound Name | [N-carbamoyl-3-[5-[5-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]anilino] acetate |
|---|---|
| PubChem CID | 87837020 |
| Molecular Formula | C28H41N3O7 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | [N-carbamoyl-3-[5-[5-[[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]anilino] acetate |
| SMILES | CC(=O)ON(C(N)=O)c1cccc(CCCCCOCCCCCNC[C@@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C28H41N3O7/c1-21(33)38-31(28(29)36)25-11-8-10-22(17-25)9-4-2-6-15-37-16-7-3-5-14-30-19-27(35)23-12-13-26(34)24(18-23)20-32/h8,10-13,17-18,27,30,32,34-35H,2-7,9,14-16,19-20H2,1H3,(H2,29,36)/t27-/m1/s1 |
| InChIKey | KVYPAHWHTNSKNL-HHHXNRCGSA-N |
| XLogP | 3.47 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|