C28H42N4O6 — CID 142276549
2-amino-N'-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]propanediamide (PubChem CID 142276549) has the molecular formula C28H42N4O6 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-amino-N'-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]propanediamide.
| Compound Name | 2-amino-N'-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]propanediamide |
|---|---|
| PubChem CID | 142276549 |
| Molecular Formula | C28H42N4O6 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 2-amino-N'-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]propanediamide |
| SMILES | NC(=O)C(N)C(=O)Nc1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C28H42N4O6/c29-26(27(30)36)28(37)32-23-10-7-9-20(16-23)8-3-6-15-38-14-5-2-1-4-13-31-18-25(35)21-11-12-24(34)22(17-21)19-33/h7,9-12,16-17,25-26,31,33-35H,1-6,8,13-15,18-19,29H2,(H2,30,36)(H,32,37)/t25-,26?/m0/s1 |
| InChIKey | YGYHUYNOBLIBID-PMCHYTPCSA-N |
| XLogP | 1.86 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|