C28H43N3O7 — CID 69446585
acetic acid;[3-[5-[5-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]phenyl]urea (PubChem CID 69446585) has the molecular formula C28H43N3O7 and a molecular weight of 533.67 g/mol. Its IUPAC name is acetic acid;[3-[5-[5-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]phenyl]urea.
| Compound Name | acetic acid;[3-[5-[5-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]phenyl]urea |
|---|---|
| PubChem CID | 69446585 |
| Molecular Formula | C28H43N3O7 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | acetic acid;[3-[5-[5-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]pentoxy]pentyl]phenyl]urea |
| SMILES | CC(=O)O.NC(=O)Nc1cccc(CCCCCOCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C26H39N3O5.C2H4O2/c27-26(33)29-23-10-7-9-20(16-23)8-3-1-5-14-34-15-6-2-4-13-28-18-25(32)21-11-12-24(31)22(17-21)19-30;1-2(3)4/h7,9-12,16-17,25,28,30-32H,1-6,8,13-15,18-19H2,(H3,27,29,33);1H3,(H,3,4)/t25-;/m0./s1 |
| InChIKey | QJULPQZUGHAZGI-UQIIZPHYSA-N |
| XLogP | 3.69 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|