C27H41N3O5 — CID 69445182
[3-[5-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]pentyl]phenyl]urea (PubChem CID 69445182) has the molecular formula C27H41N3O5 and a molecular weight of 487.64 g/mol. Its IUPAC name is [3-[5-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]pentyl]phenyl]urea.
| Compound Name | [3-[5-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]pentyl]phenyl]urea |
|---|---|
| PubChem CID | 69445182 |
| Molecular Formula | C27H41N3O5 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | [3-[5-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]pentyl]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(CCCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C27H41N3O5/c28-27(34)30-24-11-8-10-21(17-24)9-4-3-7-16-35-15-6-2-1-5-14-29-19-26(33)22-12-13-25(32)23(18-22)20-31/h8,10-13,17-18,26,29,31-33H,1-7,9,14-16,19-20H2,(H3,28,30,34)/t26-/m0/s1 |
| InChIKey | XQUZIGJILZWESW-SANMLTNESA-N |
| XLogP | 3.99 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|