C26H40N2O6S — CID 66850294
[3-[3-[7-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]phenyl]methanesulfonamide (PubChem CID 66850294) has the molecular formula C26H40N2O6S and a molecular weight of 508.68 g/mol. Its IUPAC name is [3-[3-[7-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]phenyl]methanesulfonamide.
| Compound Name | [3-[3-[7-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 66850294 |
| Molecular Formula | C26H40N2O6S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [3-[3-[7-[[2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]heptoxy]propyl]phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cccc(CCCOCCCCCCCNCC(O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C26H40N2O6S/c27-35(32,33)20-22-9-6-8-21(16-22)10-7-15-34-14-5-3-1-2-4-13-28-18-26(31)23-11-12-25(30)24(17-23)19-29/h6,8-9,11-12,16-17,26,28-31H,1-5,7,10,13-15,18-20H2,(H2,27,32,33) |
| InChIKey | PSUGPXGHEMJDRM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|