C25H38NNaO4 — CID 175593239
sodium;hydride;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol (PubChem CID 175593239) has the molecular formula C25H38NNaO4 and a molecular weight of 439.57 g/mol. Its IUPAC name is sodium;hydride;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol.
| Compound Name | sodium;hydride;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |
|---|---|
| PubChem CID | 175593239 |
| Molecular Formula | C25H38NNaO4 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | sodium;hydride;2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |
| SMILES | OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O.[H-].[Na+] |
| InChI | InChI=1S/C25H37NO4.Na.H/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21;;/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2;;/q;+1;-1 |
| InChIKey | TZRWMVKNBKQVKP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|