C61H82N2O11 — CID 130302088
bis(2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol);1-hydroxynaphthalene-2-carboxylic acid (PubChem CID 130302088) has the molecular formula C61H82N2O11 and a molecular weight of 1019.33 g/mol. Its IUPAC name is bis(2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol);1-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | bis(2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol);1-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 130302088 |
| Molecular Formula | C61H82N2O11 |
| Molecular Weight | 1019.33 g/mol |
| Exact Mass | 1018.59 |
| IUPAC Name | bis(2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol);1-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2c1O.OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O.OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O |
| InChI | InChI=1S/2C25H37NO4.C11H8O3/c2*27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21;12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h2*3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2;1-6,12H,(H,13,14) |
| InChIKey | PGOOTWYMMDCDBT-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 221.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.33 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|