C33H43NO6 — CID 142890261
2-[2-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]phenyl]acetic acid (PubChem CID 142890261) has the molecular formula C33H43NO6 and a molecular weight of 549.71 g/mol. Its IUPAC name is 2-[2-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 142890261 |
| Molecular Formula | C33H43NO6 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 2-[2-[3-[4-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]butyl]phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1-c1cccc(CCCCOCCCCCCNC[C@H](O)c2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C33H43NO6/c35-24-29-21-28(15-16-31(29)36)32(37)23-34-17-6-1-2-7-18-40-19-8-5-10-25-11-9-13-26(20-25)30-14-4-3-12-27(30)22-33(38)39/h3-4,9,11-16,20-21,32,34-37H,1-2,5-8,10,17-19,22-24H2,(H,38,39)/t32-/m0/s1 |
| InChIKey | AUWUNZLAJGYGKC-YTTGMZPUSA-N |
| XLogP | 5.40 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|