C31H41NO5 — CID 142890282
4-[(1R)-1-hydroxy-2-[6-[4-[3-(4-hydroxyphenyl)phenyl]butoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol (PubChem CID 142890282) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxy-2-[6-[4-[3-(4-hydroxyphenyl)phenyl]butoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(1R)-1-hydroxy-2-[6-[4-[3-(4-hydroxyphenyl)phenyl]butoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 142890282 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 4-[(1R)-1-hydroxy-2-[6-[4-[3-(4-hydroxyphenyl)phenyl]butoxy]hexylamino]ethyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc([C@@H](O)CNCCCCCCOCCCCc2cccc(-c3ccc(O)cc3)c2)ccc1O |
| InChI | InChI=1S/C31H41NO5/c33-23-28-21-27(13-16-30(28)35)31(36)22-32-17-4-1-2-5-18-37-19-6-3-8-24-9-7-10-26(20-24)25-11-14-29(34)15-12-25/h7,9-16,20-21,31-36H,1-6,8,17-19,22-23H2/t31-/m0/s1 |
| InChIKey | NMPCFSVWGMVBKB-HKBQPEDESA-N |
| XLogP | 5.48 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|