C32H41NO7 — CID 66845256
[3-[3-[2-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]phenyl]phenyl] acetate (PubChem CID 66845256) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is [3-[3-[2-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]phenyl]phenyl] acetate.
| Compound Name | [3-[3-[2-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 66845256 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | [3-[3-[2-[6-[[(2R)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]ethyl]amino]hexoxy]ethoxymethyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(-c2cccc(COCCOCCCCCCNC[C@H](O)c3ccc(O)c(CO)c3)c2)c1 |
| InChI | InChI=1S/C32H41NO7/c1-24(35)40-30-11-7-10-27(20-30)26-9-6-8-25(18-26)23-39-17-16-38-15-5-3-2-4-14-33-21-32(37)28-12-13-31(36)29(19-28)22-34/h6-13,18-20,32-34,36-37H,2-5,14-17,21-23H2,1H3/t32-/m0/s1 |
| InChIKey | KGCIQYDAMFEHMI-YTTGMZPUSA-N |
| XLogP | 4.89 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|